C17H21N3O2S — CID 4633095
ethyl 6-(3-aminophenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 4633095) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is ethyl 6-(3-aminophenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | ethyl 6-(3-aminophenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 4633095 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | ethyl 6-(3-aminophenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C2SCCCN2C1c1cccc(N)c1 |
| InChI | InChI=1S/C17H21N3O2S/c1-3-22-16(21)14-11(2)19-17-20(8-5-9-23-17)15(14)12-6-4-7-13(18)10-12/h4,6-7,10,15H,3,5,8-9,18H2,1-2H3 |
| InChIKey | FBJJUMFGFMWDAQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|