C29H28FN5O3S — CID 4623968
6-[3-[(2-fluorophenyl)carbamoylamino]phenyl]-N-(2-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 4623968) has the molecular formula C29H28FN5O3S and a molecular weight of 545.64 g/mol. Its IUPAC name is 6-[3-[(2-fluorophenyl)carbamoylamino]phenyl]-N-(2-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[3-[(2-fluorophenyl)carbamoylamino]phenyl]-N-(2-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 4623968 |
| Molecular Formula | C29H28FN5O3S |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 6-[3-[(2-fluorophenyl)carbamoylamino]phenyl]-N-(2-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)N=C2SCCCN2C1c1cccc(NC(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C29H28FN5O3S/c1-18-25(27(36)33-23-13-5-6-14-24(23)38-2)26(35-15-8-16-39-29(35)31-18)19-9-7-10-20(17-19)32-28(37)34-22-12-4-3-11-21(22)30/h3-7,9-14,17,26H,8,15-16H2,1-2H3,(H,33,36)(H2,32,34,37) |
| InChIKey | MGXDINHAFWGVMY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |