C28H27N3O3S2 — CID 42771832
ethyl 8-phenyl-6-[4-[(2-thiophen-2-ylacetyl)amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 42771832) has the molecular formula C28H27N3O3S2 and a molecular weight of 517.68 g/mol. Its IUPAC name is ethyl 8-phenyl-6-[4-[(2-thiophen-2-ylacetyl)amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | ethyl 8-phenyl-6-[4-[(2-thiophen-2-ylacetyl)amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 42771832 |
| Molecular Formula | C28H27N3O3S2 |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | ethyl 8-phenyl-6-[4-[(2-thiophen-2-ylacetyl)amino]phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=C2SCCCN2C1c1ccc(NC(=O)Cc2cccs2)cc1 |
| InChI | InChI=1S/C28H27N3O3S2/c1-2-34-27(33)24-25(19-8-4-3-5-9-19)30-28-31(15-7-17-36-28)26(24)20-11-13-21(14-12-20)29-23(32)18-22-10-6-16-35-22/h3-6,8-14,16,26H,2,7,15,17-18H2,1H3,(H,29,32) |
| InChIKey | YUPBXDBKTGMJTM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |