C29H33N3O3S — CID 4070576
ethyl 6-[4-(cyclohexanecarbonylamino)phenyl]-8-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate (PubChem CID 4070576) has the molecular formula C29H33N3O3S and a molecular weight of 503.67 g/mol. Its IUPAC name is ethyl 6-[4-(cyclohexanecarbonylamino)phenyl]-8-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate.
| Compound Name | ethyl 6-[4-(cyclohexanecarbonylamino)phenyl]-8-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 4070576 |
| Molecular Formula | C29H33N3O3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | ethyl 6-[4-(cyclohexanecarbonylamino)phenyl]-8-phenyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=C2SCCCN2C1c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H33N3O3S/c1-2-35-28(34)24-25(20-10-5-3-6-11-20)31-29-32(18-9-19-36-29)26(24)21-14-16-23(17-15-21)30-27(33)22-12-7-4-8-13-22/h3,5-6,10-11,14-17,22,26H,2,4,7-9,12-13,18-19H2,1H3,(H,30,33) |
| InChIKey | CCCKPXNYAFMYML-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |