C24H18N4O4 — CID 66508040
11-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methyl-5-(3-methylphenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 66508040) has the molecular formula C24H18N4O4 and a molecular weight of 426.43 g/mol. Its IUPAC name is 11-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methyl-5-(3-methylphenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 11-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methyl-5-(3-methylphenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66508040 |
| Molecular Formula | C24H18N4O4 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 11-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methyl-5-(3-methylphenyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | Cc1cccc(-n2nc(C)c3c4c(cnc32)C(=O)N(c2ccc3c(c2)OCCO3)C4=O)c1 |
| InChI | InChI=1S/C24H18N4O4/c1-13-4-3-5-16(10-13)28-22-20(14(2)26-28)21-17(12-25-22)23(29)27(24(21)30)15-6-7-18-19(11-15)32-9-8-31-18/h3-7,10-12H,8-9H2,1-2H3 |
| InChIKey | AMPXGBLIOAMISX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|