C20H18ClN5O2 — CID 66508240
1-[4-(4-chlorophenyl)pyrimidin-2-yl]-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)guanidine (PubChem CID 66508240) has the molecular formula C20H18ClN5O2 and a molecular weight of 395.85 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)pyrimidin-2-yl]-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)guanidine.
| Compound Name | 1-[4-(4-chlorophenyl)pyrimidin-2-yl]-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)guanidine |
|---|---|
| PubChem CID | 66508240 |
| Molecular Formula | C20H18ClN5O2 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-[4-(4-chlorophenyl)pyrimidin-2-yl]-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)guanidine |
| SMILES | N/C(=N\Cc1ccc2c(c1)OCCO2)Nc1nccc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H18ClN5O2/c21-15-4-2-14(3-5-15)16-7-8-23-20(25-16)26-19(22)24-12-13-1-6-17-18(11-13)28-10-9-27-17/h1-8,11H,9-10,12H2,(H3,22,23,24,25,26) |
| InChIKey | NOIPRQGQHOJNKG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|