C5H4ClF3N2O2S — CID 66509474
1-(2,2,2-trifluoroethyl)pyrazole-3-sulfonyl chloride (PubChem CID 66509474) has the molecular formula C5H4ClF3N2O2S and a molecular weight of 248.61 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)pyrazole-3-sulfonyl chloride.
| Compound Name | 1-(2,2,2-trifluoroethyl)pyrazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 66509474 |
| Molecular Formula | C5H4ClF3N2O2S |
| Molecular Weight | 248.61 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)pyrazole-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccn(CC(F)(F)F)n1 |
| InChI | InChI=1S/C5H4ClF3N2O2S/c6-14(12,13)4-1-2-11(10-4)3-5(7,8)9/h1-2H,3H2 |
| InChIKey | LHEWERHADPJETO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.61 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |