C12H19IN4O2S — CID 66509629
5-iodo-N,N-dimethyl-4-(1-methylsulfonylpiperidin-2-yl)pyrimidin-2-amine (PubChem CID 66509629) has the molecular formula C12H19IN4O2S and a molecular weight of 410.28 g/mol. Its IUPAC name is 5-iodo-N,N-dimethyl-4-(1-methylsulfonylpiperidin-2-yl)pyrimidin-2-amine.
| Compound Name | 5-iodo-N,N-dimethyl-4-(1-methylsulfonylpiperidin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 66509629 |
| Molecular Formula | C12H19IN4O2S |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 5-iodo-N,N-dimethyl-4-(1-methylsulfonylpiperidin-2-yl)pyrimidin-2-amine |
| SMILES | CN(C)c1ncc(I)c(C2CCCCN2S(C)(=O)=O)n1 |
| InChI | InChI=1S/C12H19IN4O2S/c1-16(2)12-14-8-9(13)11(15-12)10-6-4-5-7-17(10)20(3,18)19/h8,10H,4-7H2,1-3H3 |
| InChIKey | HRBXQKWEEXKJRP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|