C10H16N4O2S — CID 110269291
N-methyl-3-(1-methylsulfonylpyrrolidin-2-yl)pyrazin-2-amine (PubChem CID 110269291) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-methyl-3-(1-methylsulfonylpyrrolidin-2-yl)pyrazin-2-amine.
| Compound Name | N-methyl-3-(1-methylsulfonylpyrrolidin-2-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 110269291 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-methyl-3-(1-methylsulfonylpyrrolidin-2-yl)pyrazin-2-amine |
| SMILES | CNc1nccnc1C1CCCN1S(C)(=O)=O |
| InChI | InChI=1S/C10H16N4O2S/c1-11-10-9(12-5-6-13-10)8-4-3-7-14(8)17(2,15)16/h5-6,8H,3-4,7H2,1-2H3,(H,11,13) |
| InChIKey | FBCLSOLLIKYCGC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |