C16H15F3N2O4 — CID 66510504
(1S)-2,2,2-trifluoro-1-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]ethanamine (PubChem CID 66510504) has the molecular formula C16H15F3N2O4 and a molecular weight of 356.30 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]ethanamine.
| Compound Name | (1S)-2,2,2-trifluoro-1-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 66510504 |
| Molecular Formula | C16H15F3N2O4 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]ethanamine |
| SMILES | COc1cc([C@H](N)C(F)(F)F)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15F3N2O4/c1-24-14-8-11(15(20)16(17,18)19)4-7-13(14)25-9-10-2-5-12(6-3-10)21(22)23/h2-8,15H,9,20H2,1H3/t15-/m0/s1 |
| InChIKey | ZSJNSHXHYIOOGN-HNNXBMFYSA-N |
| XLogP | 3.74 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|