C14H20N2O3 — CID 66513297
(2S)-2-amino-2-(2,3-dimethyl-4-morpholin-4-ylphenyl)acetic acid (PubChem CID 66513297) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2S)-2-amino-2-(2,3-dimethyl-4-morpholin-4-ylphenyl)acetic acid.
| Compound Name | (2S)-2-amino-2-(2,3-dimethyl-4-morpholin-4-ylphenyl)acetic acid |
|---|---|
| PubChem CID | 66513297 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2S)-2-amino-2-(2,3-dimethyl-4-morpholin-4-ylphenyl)acetic acid |
| SMILES | Cc1c([C@H](N)C(=O)O)ccc(N2CCOCC2)c1C |
| InChI | InChI=1S/C14H20N2O3/c1-9-10(2)12(16-5-7-19-8-6-16)4-3-11(9)13(15)14(17)18/h3-4,13H,5-8,15H2,1-2H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | IXONUEZLVDEUJU-ZDUSSCGKSA-N |
| XLogP | 1.22 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |