C11H18N2O2 — CID 66518218
ethyl 2-amino-3-(3,5-dimethyl-1H-pyrrol-2-yl)propanoate (PubChem CID 66518218) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is ethyl 2-amino-3-(3,5-dimethyl-1H-pyrrol-2-yl)propanoate.
| Compound Name | ethyl 2-amino-3-(3,5-dimethyl-1H-pyrrol-2-yl)propanoate |
|---|---|
| PubChem CID | 66518218 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | ethyl 2-amino-3-(3,5-dimethyl-1H-pyrrol-2-yl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1[nH]c(C)cc1C |
| InChI | InChI=1S/C11H18N2O2/c1-4-15-11(14)9(12)6-10-7(2)5-8(3)13-10/h5,9,13H,4,6,12H2,1-3H3 |
| InChIKey | XPURYYZUBDYADJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |