C10H13NO2 — CID 66518287
4-[(2S)-pyrrolidin-2-yl]benzene-1,2-diol (PubChem CID 66518287) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-[(2S)-pyrrolidin-2-yl]benzene-1,2-diol.
| Compound Name | 4-[(2S)-pyrrolidin-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 66518287 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-[(2S)-pyrrolidin-2-yl]benzene-1,2-diol |
| SMILES | Oc1ccc([C@@H]2CCCN2)cc1O |
| InChI | InChI=1S/C10H13NO2/c12-9-4-3-7(6-10(9)13)8-2-1-5-11-8/h3-4,6,8,11-13H,1-2,5H2/t8-/m0/s1 |
| InChIKey | JVTOPHFPJFJJHB-QMMMGPOBSA-N |
| XLogP | 1.52 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|