C13H18N2 — CID 66518533
4-[(2S)-pyrrolidin-2-yl]-2,3-dihydro-1H-inden-5-amine (PubChem CID 66518533) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-[(2S)-pyrrolidin-2-yl]-2,3-dihydro-1H-inden-5-amine.
| Compound Name | 4-[(2S)-pyrrolidin-2-yl]-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 66518533 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4-[(2S)-pyrrolidin-2-yl]-2,3-dihydro-1H-inden-5-amine |
| SMILES | Nc1ccc2c(c1[C@@H]1CCCN1)CCC2 |
| InChI | InChI=1S/C13H18N2/c14-11-7-6-9-3-1-4-10(9)13(11)12-5-2-8-15-12/h6-7,12,15H,1-5,8,14H2/t12-/m0/s1 |
| InChIKey | BPOYKKWFDUHGJG-LBPRGKRZSA-N |
| XLogP | 2.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|