C21H19BrCl2N2O2 — CID 66525916
N-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methyl]-2-pyridin-2-yloxyethanamine (PubChem CID 66525916) has the molecular formula C21H19BrCl2N2O2 and a molecular weight of 482.21 g/mol. Its IUPAC name is N-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methyl]-2-pyridin-2-yloxyethanamine.
| Compound Name | N-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methyl]-2-pyridin-2-yloxyethanamine |
|---|---|
| PubChem CID | 66525916 |
| Molecular Formula | C21H19BrCl2N2O2 |
| Molecular Weight | 482.21 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | N-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methyl]-2-pyridin-2-yloxyethanamine |
| SMILES | Clc1ccc(COc2ccc(Br)cc2CNCCOc2ccccn2)cc1Cl |
| InChI | InChI=1S/C21H19BrCl2N2O2/c22-17-5-7-20(28-14-15-4-6-18(23)19(24)11-15)16(12-17)13-25-9-10-27-21-3-1-2-8-26-21/h1-8,11-12,25H,9-10,13-14H2 |
| InChIKey | NTSKQSJXXRBFPY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.21 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|