C22H21Cl3N2O2 — CID 66526751
N-[[5-chloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methyl]-3-pyridin-2-yloxypropan-1-amine (PubChem CID 66526751) has the molecular formula C22H21Cl3N2O2 and a molecular weight of 451.78 g/mol. Its IUPAC name is N-[[5-chloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methyl]-3-pyridin-2-yloxypropan-1-amine.
| Compound Name | N-[[5-chloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methyl]-3-pyridin-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 66526751 |
| Molecular Formula | C22H21Cl3N2O2 |
| Molecular Weight | 451.78 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N-[[5-chloro-2-[(2,6-dichlorophenyl)methoxy]phenyl]methyl]-3-pyridin-2-yloxypropan-1-amine |
| SMILES | Clc1ccc(OCc2c(Cl)cccc2Cl)c(CNCCCOc2ccccn2)c1 |
| InChI | InChI=1S/C22H21Cl3N2O2/c23-17-8-9-21(29-15-18-19(24)5-3-6-20(18)25)16(13-17)14-26-10-4-12-28-22-7-1-2-11-27-22/h1-3,5-9,11,13,26H,4,10,12,14-15H2 |
| InChIKey | WJESCXBGVILYNB-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.78 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|