C20H26BrNO2 — CID 66535051
N-[[2-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]butan-2-amine (PubChem CID 66535051) has the molecular formula C20H26BrNO2 and a molecular weight of 392.34 g/mol. Its IUPAC name is N-[[2-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]butan-2-amine.
| Compound Name | N-[[2-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 66535051 |
| Molecular Formula | C20H26BrNO2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-[[2-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]butan-2-amine |
| SMILES | CCC(C)NCc1cc(OC)c(OCc2ccccc2C)cc1Br |
| InChI | InChI=1S/C20H26BrNO2/c1-5-15(3)22-12-17-10-19(23-4)20(11-18(17)21)24-13-16-9-7-6-8-14(16)2/h6-11,15,22H,5,12-13H2,1-4H3 |
| InChIKey | BGSXRNDDOCGIKZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |