C20H26BrNO3 — CID 66536692
4-[[6-bromo-3-methoxy-2-[(2-methylphenyl)methoxy]phenyl]methylamino]butan-1-ol (PubChem CID 66536692) has the molecular formula C20H26BrNO3 and a molecular weight of 408.34 g/mol. Its IUPAC name is 4-[[6-bromo-3-methoxy-2-[(2-methylphenyl)methoxy]phenyl]methylamino]butan-1-ol.
| Compound Name | 4-[[6-bromo-3-methoxy-2-[(2-methylphenyl)methoxy]phenyl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 66536692 |
| Molecular Formula | C20H26BrNO3 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-[[6-bromo-3-methoxy-2-[(2-methylphenyl)methoxy]phenyl]methylamino]butan-1-ol |
| SMILES | COc1ccc(Br)c(CNCCCCO)c1OCc1ccccc1C |
| InChI | InChI=1S/C20H26BrNO3/c1-15-7-3-4-8-16(15)14-25-20-17(13-22-11-5-6-12-23)18(21)9-10-19(20)24-2/h3-4,7-10,22-23H,5-6,11-14H2,1-2H3 |
| InChIKey | QZZGMLFCUVPLCS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|