C22H29BrN2O3 — CID 66542879
N-[3-[(2-bromo-5-methoxy-4-propoxyphenyl)methylamino]phenyl]-3-methylbutanamide (PubChem CID 66542879) has the molecular formula C22H29BrN2O3 and a molecular weight of 449.39 g/mol. Its IUPAC name is N-[3-[(2-bromo-5-methoxy-4-propoxyphenyl)methylamino]phenyl]-3-methylbutanamide.
| Compound Name | N-[3-[(2-bromo-5-methoxy-4-propoxyphenyl)methylamino]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 66542879 |
| Molecular Formula | C22H29BrN2O3 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-[3-[(2-bromo-5-methoxy-4-propoxyphenyl)methylamino]phenyl]-3-methylbutanamide |
| SMILES | CCCOc1cc(Br)c(CNc2cccc(NC(=O)CC(C)C)c2)cc1OC |
| InChI | InChI=1S/C22H29BrN2O3/c1-5-9-28-21-13-19(23)16(11-20(21)27-4)14-24-17-7-6-8-18(12-17)25-22(26)10-15(2)3/h6-8,11-13,15,24H,5,9-10,14H2,1-4H3,(H,25,26) |
| InChIKey | UCUFMBUVNBJPCP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |