C20H23BrClN5O2 — CID 66543901
N-[[6-bromo-2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-1-butyltetrazol-5-amine (PubChem CID 66543901) has the molecular formula C20H23BrClN5O2 and a molecular weight of 480.79 g/mol. Its IUPAC name is N-[[6-bromo-2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-1-butyltetrazol-5-amine.
| Compound Name | N-[[6-bromo-2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-1-butyltetrazol-5-amine |
|---|---|
| PubChem CID | 66543901 |
| Molecular Formula | C20H23BrClN5O2 |
| Molecular Weight | 480.79 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | N-[[6-bromo-2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-1-butyltetrazol-5-amine |
| SMILES | CCCCn1nnnc1NCc1c(Br)ccc(OC)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C20H23BrClN5O2/c1-3-4-11-27-20(24-25-26-27)23-12-15-16(21)9-10-18(28-2)19(15)29-13-14-7-5-6-8-17(14)22/h5-10H,3-4,11-13H2,1-2H3,(H,23,24,26) |
| InChIKey | VRNRPMTXCURHRH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.79 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |