C16H27Cl2N3OS — CID 66546560
(2S)-2-(3-aminopropylamino)-3-phenyl-1-thiomorpholin-4-ylpropan-1-one;dihydrochloride (PubChem CID 66546560) has the molecular formula C16H27Cl2N3OS and a molecular weight of 380.39 g/mol. Its IUPAC name is (2S)-2-(3-aminopropylamino)-3-phenyl-1-thiomorpholin-4-ylpropan-1-one;dihydrochloride.
| Compound Name | (2S)-2-(3-aminopropylamino)-3-phenyl-1-thiomorpholin-4-ylpropan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 66546560 |
| Molecular Formula | C16H27Cl2N3OS |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (2S)-2-(3-aminopropylamino)-3-phenyl-1-thiomorpholin-4-ylpropan-1-one;dihydrochloride |
| SMILES | Cl.Cl.NCCCN[C@@H](Cc1ccccc1)C(=O)N1CCSCC1 |
| InChI | InChI=1S/C16H25N3OS.2ClH/c17-7-4-8-18-15(13-14-5-2-1-3-6-14)16(20)19-9-11-21-12-10-19;;/h1-3,5-6,15,18H,4,7-13,17H2;2*1H/t15-;;/m0../s1 |
| InChIKey | HFRRNDHHVFCARI-CKUXDGONSA-N |
| XLogP | 1.96 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|