C19H28N2OS — CID 66546555
(2S)-2-(cyclohexylamino)-3-phenyl-1-thiomorpholin-4-ylpropan-1-one (PubChem CID 66546555) has the molecular formula C19H28N2OS and a molecular weight of 332.51 g/mol. Its IUPAC name is (2S)-2-(cyclohexylamino)-3-phenyl-1-thiomorpholin-4-ylpropan-1-one.
| Compound Name | (2S)-2-(cyclohexylamino)-3-phenyl-1-thiomorpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 66546555 |
| Molecular Formula | C19H28N2OS |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (2S)-2-(cyclohexylamino)-3-phenyl-1-thiomorpholin-4-ylpropan-1-one |
| SMILES | O=C([C@H](Cc1ccccc1)NC1CCCCC1)N1CCSCC1 |
| InChI | InChI=1S/C19H28N2OS/c22-19(21-11-13-23-14-12-21)18(15-16-7-3-1-4-8-16)20-17-9-5-2-6-10-17/h1,3-4,7-8,17-18,20H,2,5-6,9-15H2/t18-/m0/s1 |
| InChIKey | BPRNUOXYOLSQEW-SFHVURJKSA-N |
| XLogP | 3.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |