C33H38F2N4 — CID 66546682
1-[bis(4-fluorophenyl)methyl]-4-[4-(1-phenyl-3-propan-2-ylpyrazol-5-yl)butyl]piperazine (PubChem CID 66546682) has the molecular formula C33H38F2N4 and a molecular weight of 528.69 g/mol. Its IUPAC name is 1-[bis(4-fluorophenyl)methyl]-4-[4-(1-phenyl-3-propan-2-ylpyrazol-5-yl)butyl]piperazine.
| Compound Name | 1-[bis(4-fluorophenyl)methyl]-4-[4-(1-phenyl-3-propan-2-ylpyrazol-5-yl)butyl]piperazine |
|---|---|
| PubChem CID | 66546682 |
| Molecular Formula | C33H38F2N4 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | 1-[bis(4-fluorophenyl)methyl]-4-[4-(1-phenyl-3-propan-2-ylpyrazol-5-yl)butyl]piperazine |
| SMILES | CC(C)c1cc(CCCCN2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C33H38F2N4/c1-25(2)32-24-31(39(36-32)30-8-4-3-5-9-30)10-6-7-19-37-20-22-38(23-21-37)33(26-11-15-28(34)16-12-26)27-13-17-29(35)18-14-27/h3-5,8-9,11-18,24-25,33H,6-7,10,19-23H2,1-2H3 |
| InChIKey | AATPPRBVJOYPFA-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|