C18H22FN5O3 — CID 66546959
[4-(4-amino-7-fluoro-6-methoxyquinazolin-2-yl)piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 66546959) has the molecular formula C18H22FN5O3 and a molecular weight of 375.40 g/mol. Its IUPAC name is [4-(4-amino-7-fluoro-6-methoxyquinazolin-2-yl)piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-(4-amino-7-fluoro-6-methoxyquinazolin-2-yl)piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 66546959 |
| Molecular Formula | C18H22FN5O3 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | [4-(4-amino-7-fluoro-6-methoxyquinazolin-2-yl)piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | COc1cc2c(N)nc(N3CCN(C(=O)C4CCCO4)CC3)nc2cc1F |
| InChI | InChI=1S/C18H22FN5O3/c1-26-15-9-11-13(10-12(15)19)21-18(22-16(11)20)24-6-4-23(5-7-24)17(25)14-3-2-8-27-14/h9-10,14H,2-8H2,1H3,(H2,20,21,22) |
| InChIKey | ILIOYDUUJGVXPS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |