C19H25N5O4 — CID 59662879
[4-[4-(dideuterioamino)-6,7-dimethoxyquinazolin-2-yl]piperazin-1-yl]-(3,3,4,4,5,5-hexadeuteriooxolan-2-yl)methanone (PubChem CID 59662879) has the molecular formula C19H25N5O4 and a molecular weight of 395.49 g/mol. Its IUPAC name is [4-[4-(dideuterioamino)-6,7-dimethoxyquinazolin-2-yl]piperazin-1-yl]-(3,3,4,4,5,5-hexadeuteriooxolan-2-yl)methanone.
| Compound Name | [4-[4-(dideuterioamino)-6,7-dimethoxyquinazolin-2-yl]piperazin-1-yl]-(3,3,4,4,5,5-hexadeuteriooxolan-2-yl)methanone |
|---|---|
| PubChem CID | 59662879 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | [4-[4-(dideuterioamino)-6,7-dimethoxyquinazolin-2-yl]piperazin-1-yl]-(3,3,4,4,5,5-hexadeuteriooxolan-2-yl)methanone |
| SMILES | [2H]N([2H])c1nc(N2CCN(C(=O)C3OC([2H])([2H])C([2H])([2H])C3([2H])[2H])CC2)nc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C19H25N5O4/c1-26-15-10-12-13(11-16(15)27-2)21-19(22-17(12)20)24-7-5-23(6-8-24)18(25)14-4-3-9-28-14/h10-11,14H,3-9H2,1-2H3,(H2,20,21,22)/i3D2,4D2,9D2/hD2 |
| InChIKey | VCKUSRYTPJJLNI-JSDYBZOQSA-N |
| XLogP | 1.06 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |