C23H25N5O5 — CID 59662845
(3,3-dideuterio-2H-1,4-benzodioxin-2-yl)-[2,2,6,6-tetradeuterio-4-[4-(dideuterioamino)-6,7-dimethoxyquinazolin-2-yl]piperazin-1-yl]methanone (PubChem CID 59662845) has the molecular formula C23H25N5O5 and a molecular weight of 459.53 g/mol. Its IUPAC name is (3,3-dideuterio-2H-1,4-benzodioxin-2-yl)-[2,2,6,6-tetradeuterio-4-[4-(dideuterioamino)-6,7-dimethoxyquinazolin-2-yl]piperazin-1-yl]methanone.
| Compound Name | (3,3-dideuterio-2H-1,4-benzodioxin-2-yl)-[2,2,6,6-tetradeuterio-4-[4-(dideuterioamino)-6,7-dimethoxyquinazolin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 59662845 |
| Molecular Formula | C23H25N5O5 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | (3,3-dideuterio-2H-1,4-benzodioxin-2-yl)-[2,2,6,6-tetradeuterio-4-[4-(dideuterioamino)-6,7-dimethoxyquinazolin-2-yl]piperazin-1-yl]methanone |
| SMILES | [2H]N([2H])c1nc(N2CC([2H])([2H])N(C(=O)C3Oc4ccccc4OC3([2H])[2H])C([2H])([2H])C2)nc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C23H25N5O5/c1-30-18-11-14-15(12-19(18)31-2)25-23(26-21(14)24)28-9-7-27(8-10-28)22(29)20-13-32-16-5-3-4-6-17(16)33-20/h3-6,11-12,20H,7-10,13H2,1-2H3,(H2,24,25,26)/i7D2,8D2,13D2/hD2 |
| InChIKey | RUZYUOTYCVRMRZ-CFJQCFMCSA-N |
| XLogP | 1.72 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |