C19H25N5O4 — CID 59662803
(3,3,4,4,5,5-hexadeuteriooxolan-2-yl)-[2,2,6,6-tetradeuterio-4-[4-(dideuterioamino)-6,7-bis(trideuteriomethoxy)quinazolin-2-yl]piperazin-1-yl]methanone (PubChem CID 59662803) has the molecular formula C19H25N5O4 and a molecular weight of 405.55 g/mol. Its IUPAC name is (3,3,4,4,5,5-hexadeuteriooxolan-2-yl)-[2,2,6,6-tetradeuterio-4-[4-(dideuterioamino)-6,7-bis(trideuteriomethoxy)quinazolin-2-yl]piperazin-1-yl]methanone.
| Compound Name | (3,3,4,4,5,5-hexadeuteriooxolan-2-yl)-[2,2,6,6-tetradeuterio-4-[4-(dideuterioamino)-6,7-bis(trideuteriomethoxy)quinazolin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 59662803 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | (3,3,4,4,5,5-hexadeuteriooxolan-2-yl)-[2,2,6,6-tetradeuterio-4-[4-(dideuterioamino)-6,7-bis(trideuteriomethoxy)quinazolin-2-yl]piperazin-1-yl]methanone |
| SMILES | [2H]N([2H])c1nc(N2CC([2H])([2H])N(C(=O)C3OC([2H])([2H])C([2H])([2H])C3([2H])[2H])C([2H])([2H])C2)nc2cc(OC([2H])([2H])[2H])c(OC([2H])([2H])[2H])cc12 |
| InChI | InChI=1S/C19H25N5O4/c1-26-15-10-12-13(11-16(15)27-2)21-19(22-17(12)20)24-7-5-23(6-8-24)18(25)14-4-3-9-28-14/h10-11,14H,3-9H2,1-2H3,(H2,20,21,22)/i1D3,2D3,3D2,4D2,5D2,6D2,9D2/hD2 |
| InChIKey | VCKUSRYTPJJLNI-GNLYLISPSA-N |
| XLogP | 1.06 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |