C24H26F3N5O — CID 66547491
8-[3-[(5R)-3-amino-6,6-difluoro-5,7,7-trimethyl-2H-1,4-oxazepin-5-yl]-4-fluoroanilino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 66547491) has the molecular formula C24H26F3N5O and a molecular weight of 457.50 g/mol. Its IUPAC name is 8-[3-[(5R)-3-amino-6,6-difluoro-5,7,7-trimethyl-2H-1,4-oxazepin-5-yl]-4-fluoroanilino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 8-[3-[(5R)-3-amino-6,6-difluoro-5,7,7-trimethyl-2H-1,4-oxazepin-5-yl]-4-fluoroanilino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 66547491 |
| Molecular Formula | C24H26F3N5O |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 8-[3-[(5R)-3-amino-6,6-difluoro-5,7,7-trimethyl-2H-1,4-oxazepin-5-yl]-4-fluoroanilino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CC1(C)OCC(N)=N[C@](C)(c2cc(NC3CCCc4cc(C#N)cnc43)ccc2F)C1(F)F |
| InChI | InChI=1S/C24H26F3N5O/c1-22(2)24(26,27)23(3,32-20(29)13-33-22)17-10-16(7-8-18(17)25)31-19-6-4-5-15-9-14(11-28)12-30-21(15)19/h7-10,12,19,31H,4-6,13H2,1-3H3,(H2,29,32)/t19?,23-/m1/s1 |
| InChIKey | DQDFNCUEKCQXCI-LEQGEALCSA-N |
| XLogP | 4.60 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |