C23H21BrN5O3S2- — CID 66547803
2-[2-[2-bromo-4-(sulfinatoamino)anilino]-2-oxoethyl]sulfanyl-1-(2,4,6-trimethylphenyl)imidazo[4,5-c]pyridine (PubChem CID 66547803) has the molecular formula C23H21BrN5O3S2- and a molecular weight of 559.49 g/mol. Its IUPAC name is 2-[2-[2-bromo-4-(sulfinatoamino)anilino]-2-oxoethyl]sulfanyl-1-(2,4,6-trimethylphenyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-[2-[2-bromo-4-(sulfinatoamino)anilino]-2-oxoethyl]sulfanyl-1-(2,4,6-trimethylphenyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 66547803 |
| Molecular Formula | C23H21BrN5O3S2- |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | 2-[2-[2-bromo-4-(sulfinatoamino)anilino]-2-oxoethyl]sulfanyl-1-(2,4,6-trimethylphenyl)imidazo[4,5-c]pyridine |
| SMILES | Cc1cc(C)c(-n2c(SCC(=O)Nc3ccc(NS(=O)[O-])cc3Br)nc3cnccc32)c(C)c1 |
| InChI | InChI=1S/C23H22BrN5O3S2/c1-13-8-14(2)22(15(3)9-13)29-20-6-7-25-11-19(20)27-23(29)33-12-21(30)26-18-5-4-16(10-17(18)24)28-34(31)32/h4-11,28H,12H2,1-3H3,(H,26,30)(H,31,32)/p-1 |
| InChIKey | XIROMAJDQBHGPU-UHFFFAOYSA-M |
| XLogP | 5.05 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|