C22H20ClN5OS — CID 66547635
N-(2-chloro-3-pyridinyl)-2-[1-(2,4,6-trimethylphenyl)imidazo[4,5-c]pyridin-2-yl]sulfanylacetamide (PubChem CID 66547635) has the molecular formula C22H20ClN5OS and a molecular weight of 437.96 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[1-(2,4,6-trimethylphenyl)imidazo[4,5-c]pyridin-2-yl]sulfanylacetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[1-(2,4,6-trimethylphenyl)imidazo[4,5-c]pyridin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 66547635 |
| Molecular Formula | C22H20ClN5OS |
| Molecular Weight | 437.96 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[1-(2,4,6-trimethylphenyl)imidazo[4,5-c]pyridin-2-yl]sulfanylacetamide |
| SMILES | Cc1cc(C)c(-n2c(SCC(=O)Nc3cccnc3Cl)nc3cnccc32)c(C)c1 |
| InChI | InChI=1S/C22H20ClN5OS/c1-13-9-14(2)20(15(3)10-13)28-18-6-8-24-11-17(18)27-22(28)30-12-19(29)26-16-5-4-7-25-21(16)23/h4-11H,12H2,1-3H3,(H,26,29) |
| InChIKey | OEAIFLUAPQKEFC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.96 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|