C15H24N2O9 — CID 66548386
cyclopropyl(3,6-diazabicyclo[3.1.1]heptan-3-yl)methanone;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid (PubChem CID 66548386) has the molecular formula C15H24N2O9 and a molecular weight of 376.36 g/mol. Its IUPAC name is cyclopropyl(3,6-diazabicyclo[3.1.1]heptan-3-yl)methanone;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid.
| Compound Name | cyclopropyl(3,6-diazabicyclo[3.1.1]heptan-3-yl)methanone;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid |
|---|---|
| PubChem CID | 66548386 |
| Molecular Formula | C15H24N2O9 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | cyclopropyl(3,6-diazabicyclo[3.1.1]heptan-3-yl)methanone;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid |
| SMILES | O=C(C1CC1)N1CC2CC(C1)N2.O=C(O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C9H14N2O.C6H10O8/c12-9(6-1-2-6)11-4-7-3-8(5-11)10-7;7-1(3(9)5(11)12)2(8)4(10)6(13)14/h6-8,10H,1-5H2;1-4,7-10H,(H,11,12)(H,13,14)/t;1-,2+,3+,4- |
| InChIKey | GZMPOTLCQLALKK-OPDGLEOBSA-N |
| XLogP | -3.43 |
| TPSA | 187.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |