C17H13N5OS — CID 66549151
[3-(4-amino-[1]benzothiolo[3,2-d]pyrimidin-7-yl)phenyl]urea (PubChem CID 66549151) has the molecular formula C17H13N5OS and a molecular weight of 335.39 g/mol. Its IUPAC name is [3-(4-amino-[1]benzothiolo[3,2-d]pyrimidin-7-yl)phenyl]urea.
| Compound Name | [3-(4-amino-[1]benzothiolo[3,2-d]pyrimidin-7-yl)phenyl]urea |
|---|---|
| PubChem CID | 66549151 |
| Molecular Formula | C17H13N5OS |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | [3-(4-amino-[1]benzothiolo[3,2-d]pyrimidin-7-yl)phenyl]urea |
| SMILES | NC(=O)Nc1cccc(-c2ccc3c(c2)sc2c(N)ncnc23)c1 |
| InChI | InChI=1S/C17H13N5OS/c18-16-15-14(20-8-21-16)12-5-4-10(7-13(12)24-15)9-2-1-3-11(6-9)22-17(19)23/h1-8H,(H2,18,20,21)(H3,19,22,23) |
| InChIKey | UZLVLEJMLNUUKU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |