C19H15N5OS — CID 44528605
1-[3-(4-aminothieno[3,2-d]pyrimidin-6-yl)phenyl]-3-phenylurea (PubChem CID 44528605) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is 1-[3-(4-aminothieno[3,2-d]pyrimidin-6-yl)phenyl]-3-phenylurea.
| Compound Name | 1-[3-(4-aminothieno[3,2-d]pyrimidin-6-yl)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 44528605 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1-[3-(4-aminothieno[3,2-d]pyrimidin-6-yl)phenyl]-3-phenylurea |
| SMILES | Nc1ncnc2cc(-c3cccc(NC(=O)Nc4ccccc4)c3)sc12 |
| InChI | InChI=1S/C19H15N5OS/c20-18-17-15(21-11-22-18)10-16(26-17)12-5-4-8-14(9-12)24-19(25)23-13-6-2-1-3-7-13/h1-11H,(H2,20,21,22)(H2,23,24,25) |
| InChIKey | XVURXSNXKLZHKP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |