C25H16FN3OS — CID 73388461
N-[4-[6-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-yl]phenyl]benzamide (PubChem CID 73388461) has the molecular formula C25H16FN3OS and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[4-[6-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-yl]phenyl]benzamide.
| Compound Name | N-[4-[6-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 73388461 |
| Molecular Formula | C25H16FN3OS |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[4-[6-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2ncnc3cc(-c4ccc(F)cc4)sc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H16FN3OS/c26-19-10-6-16(7-11-19)22-14-21-24(31-22)23(28-15-27-21)17-8-12-20(13-9-17)29-25(30)18-4-2-1-3-5-18/h1-15H,(H,29,30) |
| InChIKey | DZZJOPQTAMETOO-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |