C19H36O4Si — CID 66552945
(2R,5R,6E,8S)-5-hydroxy-2-methyl-8-tri(propan-2-yl)silyloxy-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 66552945) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is (2R,5R,6E,8S)-5-hydroxy-2-methyl-8-tri(propan-2-yl)silyloxy-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,5R,6E,8S)-5-hydroxy-2-methyl-8-tri(propan-2-yl)silyloxy-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 66552945 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (2R,5R,6E,8S)-5-hydroxy-2-methyl-8-tri(propan-2-yl)silyloxy-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | CC(C)[Si](O[C@@H]1/C=C/[C@H](O)CC[C@@H](C)OC(=O)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-13(2)24(14(3)4,15(5)6)23-18-11-10-17(20)9-8-16(7)22-19(21)12-18/h10-11,13-18,20H,8-9,12H2,1-7H3/b11-10+/t16-,17-,18-/m1/s1 |
| InChIKey | HRTBVBSIHVEGIX-YLDLBQQMSA-N |
| XLogP | 4.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|