C26H42Si2 — CID 66553459
tri(propan-2-yl)-[8-tri(propan-2-yl)silylocta-1,3,5,7-tetraynyl]silane (PubChem CID 66553459) has the molecular formula C26H42Si2 and a molecular weight of 410.79 g/mol. Its IUPAC name is tri(propan-2-yl)-[8-tri(propan-2-yl)silylocta-1,3,5,7-tetraynyl]silane.
| Compound Name | tri(propan-2-yl)-[8-tri(propan-2-yl)silylocta-1,3,5,7-tetraynyl]silane |
|---|---|
| PubChem CID | 66553459 |
| Molecular Formula | C26H42Si2 |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | tri(propan-2-yl)-[8-tri(propan-2-yl)silylocta-1,3,5,7-tetraynyl]silane |
| SMILES | CC(C)[Si](C#CC#CC#CC#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H42Si2/c1-21(2)27(22(3)4,23(5)6)19-17-15-13-14-16-18-20-28(24(7)8,25(9)10)26(11)12/h21-26H,1-12H3 |
| InChIKey | ZDXINHDRYHJOPV-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|