C18H16Cl2FN5O — CID 66553511
2-amino-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide (PubChem CID 66553511) has the molecular formula C18H16Cl2FN5O and a molecular weight of 408.26 g/mol. Its IUPAC name is 2-amino-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide.
| Compound Name | 2-amino-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66553511 |
| Molecular Formula | C18H16Cl2FN5O |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2-amino-N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1cc(-c2cnn(C)c2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C18H16Cl2FN5O/c1-9(15-13(19)3-4-14(21)16(15)20)25-18(27)12-5-10(6-23-17(12)22)11-7-24-26(2)8-11/h3-9H,1-2H3,(H2,22,23)(H,25,27) |
| InChIKey | SJNLAUPYSAFIFO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|