C22H16Cl4N2O2 — CID 66554989
(E)-N-[(2,4-dichlorophenyl)methoxy]-1-[4-[(E)-(2,4-dichlorophenyl)methoxyiminomethyl]phenyl]methanimine (PubChem CID 66554989) has the molecular formula C22H16Cl4N2O2 and a molecular weight of 482.19 g/mol. Its IUPAC name is (E)-N-[(2,4-dichlorophenyl)methoxy]-1-[4-[(E)-(2,4-dichlorophenyl)methoxyiminomethyl]phenyl]methanimine.
| Compound Name | (E)-N-[(2,4-dichlorophenyl)methoxy]-1-[4-[(E)-(2,4-dichlorophenyl)methoxyiminomethyl]phenyl]methanimine |
|---|---|
| PubChem CID | 66554989 |
| Molecular Formula | C22H16Cl4N2O2 |
| Molecular Weight | 482.19 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | (E)-N-[(2,4-dichlorophenyl)methoxy]-1-[4-[(E)-(2,4-dichlorophenyl)methoxyiminomethyl]phenyl]methanimine |
| SMILES | Clc1ccc(CO/N=C/c2ccc(/C=N/OCc3ccc(Cl)cc3Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C22H16Cl4N2O2/c23-19-7-5-17(21(25)9-19)13-29-27-11-15-1-2-16(4-3-15)12-28-30-14-18-6-8-20(24)10-22(18)26/h1-12H,13-14H2/b27-11+,28-12+ |
| InChIKey | LXBTVRHREIRRPD-NXMZODBASA-N |
| XLogP | 7.40 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.19 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|