C24H19Cl2NO — CID 138377268
(1E,4E)-N-[(2,4-dichlorophenyl)methoxy]-1,5-diphenylpenta-1,4-dien-3-imine (PubChem CID 138377268) has the molecular formula C24H19Cl2NO and a molecular weight of 408.33 g/mol. Its IUPAC name is (1E,4E)-N-[(2,4-dichlorophenyl)methoxy]-1,5-diphenylpenta-1,4-dien-3-imine.
| Compound Name | (1E,4E)-N-[(2,4-dichlorophenyl)methoxy]-1,5-diphenylpenta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 138377268 |
| Molecular Formula | C24H19Cl2NO |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (1E,4E)-N-[(2,4-dichlorophenyl)methoxy]-1,5-diphenylpenta-1,4-dien-3-imine |
| SMILES | Clc1ccc(CON=C(/C=C/c2ccccc2)/C=C/c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C24H19Cl2NO/c25-22-14-13-21(24(26)17-22)18-28-27-23(15-11-19-7-3-1-4-8-19)16-12-20-9-5-2-6-10-20/h1-17H,18H2/b15-11+,16-12+ |
| InChIKey | IMBPBWPGMMVYOS-JOBJLJCHSA-N |
| XLogP | 7.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|