C34H33NO7S — CID 66556689
2-[4-[2-cyclopropyl-3-[(E)-2-[(2S,4R)-4-hydroxy-6-oxooxan-2-yl]ethenyl]quinolin-4-yl]phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 66556689) has the molecular formula C34H33NO7S and a molecular weight of 599.71 g/mol. Its IUPAC name is 2-[4-[2-cyclopropyl-3-[(E)-2-[(2S,4R)-4-hydroxy-6-oxooxan-2-yl]ethenyl]quinolin-4-yl]phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-[2-cyclopropyl-3-[(E)-2-[(2S,4R)-4-hydroxy-6-oxooxan-2-yl]ethenyl]quinolin-4-yl]phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 66556689 |
| Molecular Formula | C34H33NO7S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 2-[4-[2-cyclopropyl-3-[(E)-2-[(2S,4R)-4-hydroxy-6-oxooxan-2-yl]ethenyl]quinolin-4-yl]phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccc(-c3c(/C=C/[C@@H]4C[C@@H](O)CC(=O)O4)c(C4CC4)nc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C34H33NO7S/c1-22-6-15-28(16-7-22)43(38,39)41-19-18-40-26-12-10-23(11-13-26)33-29-4-2-3-5-31(29)35-34(24-8-9-24)30(33)17-14-27-20-25(36)21-32(37)42-27/h2-7,10-17,24-25,27,36H,8-9,18-21H2,1H3/b17-14+/t25-,27-/m1/s1 |
| InChIKey | JRLQSADTGVZPEJ-ZNECDTIWSA-N |
| XLogP | 5.95 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|