2-methylbut-2-enoic acid

C5H8O2 — CID 6656

IUPAC2-methylbut-2-enoic acid
SMILESCC=C(C)C(=O)O
InChIInChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)
InChIKeyUIERETOOQGIECD-UHFFFAOYSA-N
MW100.12 g/mol
LogP1.04
Rot. Bonds1

About 2-methylbut-2-enoic acid

2-methylbut-2-enoic acid (PubChem CID 6656) has the molecular formula C5H8O2 and a molecular weight of 100.12 g/mol. Its IUPAC name is 2-methylbut-2-enoic acid.

Molecular Properties

Compound Name2-methylbut-2-enoic acid
PubChem CID6656
Molecular FormulaC5H8O2
Molecular Weight100.12 g/mol
Exact Mass100.05
IUPAC Name2-methylbut-2-enoic acid
SMILESCC=C(C)C(=O)O
InChIInChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)
InChIKeyUIERETOOQGIECD-UHFFFAOYSA-N
XLogP1.04
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500100.12
LogP ≤ 51.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-methylbut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylbut-2-enoic acid?
The IUPAC name of 2-methylbut-2-enoic acid (CID 6656) is 2-methylbut-2-enoic acid.
What is the SMILES notation for 2-methylbut-2-enoic acid?
The canonical SMILES for 2-methylbut-2-enoic acid is CC=C(C)C(=O)O.
What is the InChIKey of 2-methylbut-2-enoic acid?
The InChIKey is UIERETOOQGIECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7).
What are the key properties of 2-methylbut-2-enoic acid?
2-methylbut-2-enoic acid has a molecular weight of 100.12 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-2-enoic acid is sourced from PubChem (CID 6656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).