C19H31N3O2 — CID 66564369
benzyl N-[4-[2-aminoethyl(propan-2-yl)amino]cyclohexyl]carbamate (PubChem CID 66564369) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is benzyl N-[4-[2-aminoethyl(propan-2-yl)amino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[2-aminoethyl(propan-2-yl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 66564369 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | benzyl N-[4-[2-aminoethyl(propan-2-yl)amino]cyclohexyl]carbamate |
| SMILES | CC(C)N(CCN)C1CCC(NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H31N3O2/c1-15(2)22(13-12-20)18-10-8-17(9-11-18)21-19(23)24-14-16-6-4-3-5-7-16/h3-7,15,17-18H,8-14,20H2,1-2H3,(H,21,23) |
| InChIKey | CMOGGQYLBFWIAU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |