C34H27ClN2O7 — CID 6656540
3-[(3aS,6R,6aS,9aR,10aS,10bR)-6-(5-chloro-2-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid (PubChem CID 6656540) has the molecular formula C34H27ClN2O7 and a molecular weight of 611.05 g/mol. Its IUPAC name is 3-[(3aS,6R,6aS,9aR,10aS,10bR)-6-(5-chloro-2-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[(3aS,6R,6aS,9aR,10aS,10bR)-6-(5-chloro-2-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 6656540 |
| Molecular Formula | C34H27ClN2O7 |
| Molecular Weight | 611.05 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | 3-[(3aS,6R,6aS,9aR,10aS,10bR)-6-(5-chloro-2-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]benzoic acid |
| SMILES | C[C@@]12C(=O)N(c3ccccc3)C(=O)[C@@H]1C[C@@H]1C(=CC[C@@H]3C(=O)N(c4cccc(C(=O)O)c4)C(=O)[C@@H]31)[C@@H]2c1cc(Cl)ccc1O |
| InChI | InChI=1S/C34H27ClN2O7/c1-34-25(30(40)37(33(34)44)19-7-3-2-4-8-19)16-23-21(28(34)24-15-18(35)10-13-26(24)38)11-12-22-27(23)31(41)36(29(22)39)20-9-5-6-17(14-20)32(42)43/h2-11,13-15,22-23,25,27-28,38H,12,16H2,1H3,(H,42,43)/t22-,23+,25-,27-,28+,34+/m0/s1 |
| InChIKey | JBUPXZBCDSDTKD-GINRTPGTSA-N |
| XLogP | 5.18 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.05 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|