C37H34ClN3O6 — CID 4624866
6-(5-chloro-2-hydroxyphenyl)-6a-methyl-2-(4-morpholin-4-ylphenyl)-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4624866) has the molecular formula C37H34ClN3O6 and a molecular weight of 652.15 g/mol. Its IUPAC name is 6-(5-chloro-2-hydroxyphenyl)-6a-methyl-2-(4-morpholin-4-ylphenyl)-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(5-chloro-2-hydroxyphenyl)-6a-methyl-2-(4-morpholin-4-ylphenyl)-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4624866 |
| Molecular Formula | C37H34ClN3O6 |
| Molecular Weight | 652.15 g/mol |
| Exact Mass | 651.21 |
| IUPAC Name | 6-(5-chloro-2-hydroxyphenyl)-6a-methyl-2-(4-morpholin-4-ylphenyl)-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC12C(=O)N(c3ccccc3)C(=O)C1CC1C(=CCC3C(=O)N(c4ccc(N5CCOCC5)cc4)C(=O)C31)C2c1cc(Cl)ccc1O |
| InChI | InChI=1S/C37H34ClN3O6/c1-37-29(34(44)41(36(37)46)23-5-3-2-4-6-23)20-27-25(32(37)28-19-21(38)7-14-30(28)42)12-13-26-31(27)35(45)40(33(26)43)24-10-8-22(9-11-24)39-15-17-47-18-16-39/h2-12,14,19,26-27,29,31-32,42H,13,15-18,20H2,1H3 |
| InChIKey | BBGIQLMMAUEUBO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.15 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|