C38H36IN3O7 — CID 4102284
6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a-methyl-2-(4-morpholin-4-ylphenyl)-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4102284) has the molecular formula C38H36IN3O7 and a molecular weight of 773.62 g/mol. Its IUPAC name is 6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a-methyl-2-(4-morpholin-4-ylphenyl)-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a-methyl-2-(4-morpholin-4-ylphenyl)-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4102284 |
| Molecular Formula | C38H36IN3O7 |
| Molecular Weight | 773.62 g/mol |
| Exact Mass | 773.16 |
| IUPAC Name | 6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a-methyl-2-(4-morpholin-4-ylphenyl)-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5ccc(N6CCOCC6)cc5)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C32C)cc(I)c1O |
| InChI | InChI=1S/C38H36IN3O7/c1-38-28(35(45)42(37(38)47)23-6-4-3-5-7-23)20-27-25(32(38)21-18-29(39)33(43)30(19-21)48-2)12-13-26-31(27)36(46)41(34(26)44)24-10-8-22(9-11-24)40-14-16-49-17-15-40/h3-12,18-19,26-28,31-32,43H,13-17,20H2,1-2H3 |
| InChIKey | YQTYHRRIUDUPFG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|