C28H25IN2O6 — CID 3342947
6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3342947) has the molecular formula C28H25IN2O6 and a molecular weight of 612.42 g/mol. Its IUPAC name is 6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3342947 |
| Molecular Formula | C28H25IN2O6 |
| Molecular Weight | 612.42 g/mol |
| Exact Mass | 612.08 |
| IUPAC Name | 6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)NC(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C32C)cc(I)c1O |
| InChI | InChI=1S/C28H25IN2O6/c1-28-18(26(35)31(27(28)36)14-6-4-3-5-7-14)12-17-15(8-9-16-21(17)25(34)30-24(16)33)22(28)13-10-19(29)23(32)20(11-13)37-2/h3-8,10-11,16-18,21-22,32H,9,12H2,1-2H3,(H,30,33,34) |
| InChIKey | RNCUMMWIPZZXFX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|