C16H17N3O — CID 665694
2-(3,5-dimethylanilino)-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 665694) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-(3,5-dimethylanilino)-7,8-dihydro-6H-quinazolin-5-one.
| Compound Name | 2-(3,5-dimethylanilino)-7,8-dihydro-6H-quinazolin-5-one |
|---|---|
| PubChem CID | 665694 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-(3,5-dimethylanilino)-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | Cc1cc(C)cc(Nc2ncc3c(n2)CCCC3=O)c1 |
| InChI | InChI=1S/C16H17N3O/c1-10-6-11(2)8-12(7-10)18-16-17-9-13-14(19-16)4-3-5-15(13)20/h6-9H,3-5H2,1-2H3,(H,17,18,19) |
| InChIKey | USZPQRMQYJIDII-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |