C10H16ClN3O2S — CID 66570297
N-(pyrrolidin-2-ylmethyl)pyridine-2-sulfonamide;hydrochloride (PubChem CID 66570297) has the molecular formula C10H16ClN3O2S and a molecular weight of 277.78 g/mol. Its IUPAC name is N-(pyrrolidin-2-ylmethyl)pyridine-2-sulfonamide;hydrochloride.
| Compound Name | N-(pyrrolidin-2-ylmethyl)pyridine-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 66570297 |
| Molecular Formula | C10H16ClN3O2S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(pyrrolidin-2-ylmethyl)pyridine-2-sulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(NCC1CCCN1)c1ccccn1 |
| InChI | InChI=1S/C10H15N3O2S.ClH/c14-16(15,10-5-1-2-6-12-10)13-8-9-4-3-7-11-9;/h1-2,5-6,9,11,13H,3-4,7-8H2;1H |
| InChIKey | SSNPTZDYTCRAOT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |