C13H21N3O2S — CID 97162061
(1S)-N-[[(2S)-piperidin-2-yl]methyl]-1-pyridin-2-ylethanesulfonamide (PubChem CID 97162061) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is (1S)-N-[[(2S)-piperidin-2-yl]methyl]-1-pyridin-2-ylethanesulfonamide.
| Compound Name | (1S)-N-[[(2S)-piperidin-2-yl]methyl]-1-pyridin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 97162061 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (1S)-N-[[(2S)-piperidin-2-yl]methyl]-1-pyridin-2-ylethanesulfonamide |
| SMILES | C[C@@H](c1ccccn1)S(=O)(=O)NC[C@@H]1CCCCN1 |
| InChI | InChI=1S/C13H21N3O2S/c1-11(13-7-3-5-9-15-13)19(17,18)16-10-12-6-2-4-8-14-12/h3,5,7,9,11-12,14,16H,2,4,6,8,10H2,1H3/t11-,12-/m0/s1 |
| InChIKey | WKOTWOSRWMISTG-RYUDHWBXSA-N |
| XLogP | 1.20 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |