C4H9F3N2O2S — CID 66570561
1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane (PubChem CID 66570561) has the molecular formula C4H9F3N2O2S and a molecular weight of 206.19 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane.
| Compound Name | 1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane |
|---|---|
| PubChem CID | 66570561 |
| Molecular Formula | C4H9F3N2O2S |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 1,1,1-trifluoro-2-[methyl(sulfamoyl)amino]propane |
| SMILES | CC(N(C)S(N)(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C4H9F3N2O2S/c1-3(4(5,6)7)9(2)12(8,10)11/h3H,1-2H3,(H2,8,10,11) |
| InChIKey | PUSUXZZTNUXPQJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |